C22H28FN3O2 — CID 124607905
(2S)-N-(4-fluorophenyl)-2-[4-[(2S)-1-hydroxybutan-2-yl]piperazin-1-yl]-2-phenylacetamide (PubChem CID 124607905) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is (2S)-N-(4-fluorophenyl)-2-[4-[(2S)-1-hydroxybutan-2-yl]piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-N-(4-fluorophenyl)-2-[4-[(2S)-1-hydroxybutan-2-yl]piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 124607905 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (2S)-N-(4-fluorophenyl)-2-[4-[(2S)-1-hydroxybutan-2-yl]piperazin-1-yl]-2-phenylacetamide |
| SMILES | CC[C@@H](CO)N1CCN([C@H](C(=O)Nc2ccc(F)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28FN3O2/c1-2-20(16-27)25-12-14-26(15-13-25)21(17-6-4-3-5-7-17)22(28)24-19-10-8-18(23)9-11-19/h3-11,20-21,27H,2,12-16H2,1H3,(H,24,28)/t20-,21-/m0/s1 |
| InChIKey | RWXHQIPMJGODST-SFTDATJTSA-N |
| XLogP | 2.89 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |