C13H16ClF2N3O — CID 124608563
1-[(3S)-1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(2,2-difluoroethyl)urea (PubChem CID 124608563) has the molecular formula C13H16ClF2N3O and a molecular weight of 303.74 g/mol. Its IUPAC name is 1-[(3S)-1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(2,2-difluoroethyl)urea.
| Compound Name | 1-[(3S)-1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 124608563 |
| Molecular Formula | C13H16ClF2N3O |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[(3S)-1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)N[C@H]1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H16ClF2N3O/c14-9-2-1-3-11(6-9)19-5-4-10(8-19)18-13(20)17-7-12(15)16/h1-3,6,10,12H,4-5,7-8H2,(H2,17,18,20)/t10-/m0/s1 |
| InChIKey | MCTUQYBEOQLXMB-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |