C14H17N3OS3 — CID 124608802
N-[(2S)-1-(2-methylphenyl)propan-2-yl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 124608802) has the molecular formula C14H17N3OS3 and a molecular weight of 339.51 g/mol. Its IUPAC name is N-[(2S)-1-(2-methylphenyl)propan-2-yl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-[(2S)-1-(2-methylphenyl)propan-2-yl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 124608802 |
| Molecular Formula | C14H17N3OS3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[(2S)-1-(2-methylphenyl)propan-2-yl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | Cc1ccccc1C[C@H](C)NC(=O)CSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C14H17N3OS3/c1-9-5-3-4-6-11(9)7-10(2)15-12(18)8-20-14-17-16-13(19)21-14/h3-6,10H,7-8H2,1-2H3,(H,15,18)(H,16,19)/t10-/m0/s1 |
| InChIKey | CJZNSGONOFSPFT-JTQLQIEISA-N |
| XLogP | 3.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|