C16H19BrN4O — CID 124611500
[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-[3-bromo-1-(4-methylphenyl)pyrazol-5-yl]methanone (PubChem CID 124611500) has the molecular formula C16H19BrN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is [(3S)-3-(aminomethyl)pyrrolidin-1-yl]-[3-bromo-1-(4-methylphenyl)pyrazol-5-yl]methanone.
| Compound Name | [(3S)-3-(aminomethyl)pyrrolidin-1-yl]-[3-bromo-1-(4-methylphenyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 124611500 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [(3S)-3-(aminomethyl)pyrrolidin-1-yl]-[3-bromo-1-(4-methylphenyl)pyrazol-5-yl]methanone |
| SMILES | Cc1ccc(-n2nc(Br)cc2C(=O)N2CC[C@@H](CN)C2)cc1 |
| InChI | InChI=1S/C16H19BrN4O/c1-11-2-4-13(5-3-11)21-14(8-15(17)19-21)16(22)20-7-6-12(9-18)10-20/h2-5,8,12H,6-7,9-10,18H2,1H3/t12-/m0/s1 |
| InChIKey | ALITWMIWUGJBFB-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |