C16H22ClFN2O — CID 124614479
(3R)-1-(4-chloro-3-fluorophenyl)-N-[(1S)-1-[(3R)-oxolan-3-yl]ethyl]pyrrolidin-3-amine (PubChem CID 124614479) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is (3R)-1-(4-chloro-3-fluorophenyl)-N-[(1S)-1-[(3R)-oxolan-3-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-(4-chloro-3-fluorophenyl)-N-[(1S)-1-[(3R)-oxolan-3-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 124614479 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3R)-1-(4-chloro-3-fluorophenyl)-N-[(1S)-1-[(3R)-oxolan-3-yl]ethyl]pyrrolidin-3-amine |
| SMILES | C[C@H](N[C@@H]1CCN(c2ccc(Cl)c(F)c2)C1)[C@H]1CCOC1 |
| InChI | InChI=1S/C16H22ClFN2O/c1-11(12-5-7-21-10-12)19-13-4-6-20(9-13)14-2-3-15(17)16(18)8-14/h2-3,8,11-13,19H,4-7,9-10H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | YWOVAYUCOJONLI-RWMBFGLXSA-N |
| XLogP | 3.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |