C17H27NO4S — CID 124615175
N-benzyl-N-(2-hydroxy-2-methylpropyl)-1-[(2R)-oxan-2-yl]methanesulfonamide (PubChem CID 124615175) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxy-2-methylpropyl)-1-[(2R)-oxan-2-yl]methanesulfonamide.
| Compound Name | N-benzyl-N-(2-hydroxy-2-methylpropyl)-1-[(2R)-oxan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 124615175 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-benzyl-N-(2-hydroxy-2-methylpropyl)-1-[(2R)-oxan-2-yl]methanesulfonamide |
| SMILES | CC(C)(O)CN(Cc1ccccc1)S(=O)(=O)C[C@H]1CCCCO1 |
| InChI | InChI=1S/C17H27NO4S/c1-17(2,19)14-18(12-15-8-4-3-5-9-15)23(20,21)13-16-10-6-7-11-22-16/h3-5,8-9,16,19H,6-7,10-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | WJMGONOHMOIQBH-MRXNPFEDSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |