About (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide
(3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide (PubChem CID 124615845) has the molecular formula C17H32N2O3
and a molecular weight of 312.45 g/mol. Its IUPAC name is (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide |
| PubChem CID | 124615845 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide |
| SMILES | CCC(CC)[C@@H]1C[C@@H](NC(=O)N2CCC[C@H](OC)C2)CCO1 |
| InChI | InChI=1S/C17H32N2O3/c1-4-13(5-2)16-11-14(8-10-22-16)18-17(20)19-9-6-7-15(12-19)21-3/h13-16H,4-12H2,1-3H3,(H,18,20)/t14-,15-,16-/m0/s1 |
| InChIKey | IXFLIMNDCQZLQS-JYJNAYRXSA-N |
| XLogP | 2.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide?
The IUPAC name of (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide (CID 124615845) is (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide.
What is the SMILES notation for (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide?
The canonical SMILES for (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide is CCC(CC)[C@@H]1C[C@@H](NC(=O)N2CCC[C@H](OC)C2)CCO1.
What is the InChIKey of (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide?
The InChIKey is IXFLIMNDCQZLQS-JYJNAYRXSA-N. The full InChI is InChI=1S/C17H32N2O3/c1-4-13(5-2)16-11-14(8-10-22-16)18-17(20)19-9-6-7-15(12-19)21-3/h13-16H,4-12H2,1-3H3,(H,18,20)/t14-,15-,16-/m0/s1.
What are the key properties of (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide?
(3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide has a molecular weight of 312.45 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methoxy-N-[(2S,4S)-2-pentan-3-yloxan-4-yl]piperidine-1-carboxamide is sourced from PubChem (CID 124615845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).