C16H21N5O2S — CID 124617062
N-[2-[[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]carbamoylamino]ethyl]pyridine-3-carboxamide (PubChem CID 124617062) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[2-[[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]carbamoylamino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]carbamoylamino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124617062 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[2-[[(2R)-2-(4-methyl-1,3-thiazol-2-yl)propyl]carbamoylamino]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1csc([C@H](C)CNC(=O)NCCNC(=O)c2cccnc2)n1 |
| InChI | InChI=1S/C16H21N5O2S/c1-11(15-21-12(2)10-24-15)8-20-16(23)19-7-6-18-14(22)13-4-3-5-17-9-13/h3-5,9-11H,6-8H2,1-2H3,(H,18,22)(H2,19,20,23)/t11-/m1/s1 |
| InChIKey | LQQWPTLJELRIGC-LLVKDONJSA-N |
| XLogP | 1.68 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|