About (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide
(2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide (PubChem CID 124618216) has the molecular formula C17H23NO3S
and a molecular weight of 321.44 g/mol. Its IUPAC name is (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide |
| PubChem CID | 124618216 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide |
| SMILES | CCc1ccccc1CNC(=O)[C@@H]1CC12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C17H23NO3S/c1-2-13-5-3-4-6-14(13)12-18-16(19)15-11-17(15)7-9-22(20,21)10-8-17/h3-6,15H,2,7-12H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | QPKKBQXZVUISJX-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide?
The IUPAC name of (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide (CID 124618216) is (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide?
The canonical SMILES for (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide is CCc1ccccc1CNC(=O)[C@@H]1CC12CCS(=O)(=O)CC2.
What is the InChIKey of (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide?
The InChIKey is QPKKBQXZVUISJX-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H23NO3S/c1-2-13-5-3-4-6-14(13)12-18-16(19)15-11-17(15)7-9-22(20,21)10-8-17/h3-6,15H,2,7-12H2,1H3,(H,18,19)/t15-/m0/s1.
What are the key properties of (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide?
(2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide has a molecular weight of 321.44 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(2-ethylphenyl)methyl]-6,6-dioxo-6λ6-thiaspiro[2.5]octane-2-carboxamide is sourced from PubChem (CID 124618216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).