C16H20N4O3 — CID 124618372
(9aS)-N-benzyl-N-methyl-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 124618372) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (9aS)-N-benzyl-N-methyl-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aS)-N-benzyl-N-methyl-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124618372 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (9aS)-N-benzyl-N-methyl-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)N1CCN2C(=O)C(=O)NC[C@H]2C1 |
| InChI | InChI=1S/C16H20N4O3/c1-18(10-12-5-3-2-4-6-12)16(23)19-7-8-20-13(11-19)9-17-14(21)15(20)22/h2-6,13H,7-11H2,1H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | OXIAIZBKFQRYFT-ZDUSSCGKSA-N |
| XLogP | -0.12 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|