C15H25N3O2 — CID 124618478
N-[(2R)-but-3-yn-2-yl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide (PubChem CID 124618478) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[(2R)-but-3-yn-2-yl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide.
| Compound Name | N-[(2R)-but-3-yn-2-yl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 124618478 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-[(2R)-but-3-yn-2-yl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
| SMILES | C#C[C@@H](C)NC(=O)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H25N3O2/c1-3-13(2)16-15(19)18-6-4-14(5-7-18)12-17-8-10-20-11-9-17/h1,13-14H,4-12H2,2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | XITGGSRZLBMPDP-CYBMUJFWSA-N |
| XLogP | 0.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|