C16H21NO4S — CID 124618500
(2R)-2,4-dimethyl-1-(6-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-4-yl)pent-4-en-1-one (PubChem CID 124618500) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-1-(6-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-4-yl)pent-4-en-1-one.
| Compound Name | (2R)-2,4-dimethyl-1-(6-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-4-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 124618500 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R)-2,4-dimethyl-1-(6-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-4-yl)pent-4-en-1-one |
| SMILES | C=C(C)C[C@@H](C)C(=O)N1CCOc2ccc(S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C16H21NO4S/c1-11(2)9-12(3)16(18)17-7-8-21-15-6-5-13(10-14(15)17)22(4,19)20/h5-6,10,12H,1,7-9H2,2-4H3/t12-/m1/s1 |
| InChIKey | TUHBUXKQIQHNGL-GFCCVEGCSA-N |
| XLogP | 2.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|