About (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one
(3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one (PubChem CID 124619380) has the molecular formula C17H16BrNO2
and a molecular weight of 346.22 g/mol. Its IUPAC name is (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one |
| PubChem CID | 124619380 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one |
| SMILES | O=C(C[C@H](O)c1ccccc1)N1Cc2cccc(Br)c2C1 |
| InChI | InChI=1S/C17H16BrNO2/c18-15-8-4-7-13-10-19(11-14(13)15)17(21)9-16(20)12-5-2-1-3-6-12/h1-8,16,20H,9-11H2/t16-/m0/s1 |
| InChIKey | KETJRBLXYKMJNU-INIZCTEOSA-N |
| XLogP | 3.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one?
The IUPAC name of (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one (CID 124619380) is (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one.
What is the SMILES notation for (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one?
The canonical SMILES for (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one is O=C(C[C@H](O)c1ccccc1)N1Cc2cccc(Br)c2C1.
What is the InChIKey of (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one?
The InChIKey is KETJRBLXYKMJNU-INIZCTEOSA-N. The full InChI is InChI=1S/C17H16BrNO2/c18-15-8-4-7-13-10-19(11-14(13)15)17(21)9-16(20)12-5-2-1-3-6-12/h1-8,16,20H,9-11H2/t16-/m0/s1.
What are the key properties of (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one?
(3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one has a molecular weight of 346.22 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4-bromo-1,3-dihydroisoindol-2-yl)-3-hydroxy-3-phenylpropan-1-one is sourced from PubChem (CID 124619380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).