About [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol
[(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol (PubChem CID 124619875) has the molecular formula C13H21F2N3O
and a molecular weight of 273.33 g/mol. Its IUPAC name is [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol |
| PubChem CID | 124619875 |
| Molecular Formula | C13H21F2N3O |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol |
| SMILES | C[C@H]1CC[C@](CO)(N(C)Cc2nccn2C(F)F)C1 |
| InChI | InChI=1S/C13H21F2N3O/c1-10-3-4-13(7-10,9-19)17(2)8-11-16-5-6-18(11)12(14)15/h5-6,10,12,19H,3-4,7-9H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | PBYOEGCJXOCXGV-GWCFXTLKSA-N |
| XLogP | 2.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol?
The IUPAC name of [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol (CID 124619875) is [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol.
What is the SMILES notation for [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol?
The canonical SMILES for [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol is C[C@H]1CC[C@](CO)(N(C)Cc2nccn2C(F)F)C1.
What is the InChIKey of [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol?
The InChIKey is PBYOEGCJXOCXGV-GWCFXTLKSA-N. The full InChI is InChI=1S/C13H21F2N3O/c1-10-3-4-13(7-10,9-19)17(2)8-11-16-5-6-18(11)12(14)15/h5-6,10,12,19H,3-4,7-9H2,1-2H3/t10-,13-/m0/s1.
What are the key properties of [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol?
[(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol has a molecular weight of 273.33 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-methylcyclopentyl]methanol is sourced from PubChem (CID 124619875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).