About 1,2,3-trimethoxybenzene
1,2,3-trimethoxybenzene (PubChem CID 12462) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 1,2,3-trimethoxybenzene.
Molecular Properties
| Compound Name | 1,2,3-trimethoxybenzene |
| PubChem CID | 12462 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1,2,3-trimethoxybenzene |
| SMILES | COc1cccc(OC)c1OC |
| InChI | InChI=1S/C9H12O3/c1-10-7-5-4-6-8(11-2)9(7)12-3/h4-6H,1-3H3 |
| InChIKey | CRUILBNAQILVHZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethoxybenzene?
The IUPAC name of 1,2,3-trimethoxybenzene (CID 12462) is 1,2,3-trimethoxybenzene.
What is the SMILES notation for 1,2,3-trimethoxybenzene?
The canonical SMILES for 1,2,3-trimethoxybenzene is COc1cccc(OC)c1OC.
What is the InChIKey of 1,2,3-trimethoxybenzene?
The InChIKey is CRUILBNAQILVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-10-7-5-4-6-8(11-2)9(7)12-3/h4-6H,1-3H3.
What are the key properties of 1,2,3-trimethoxybenzene?
1,2,3-trimethoxybenzene has a molecular weight of 168.19 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethoxybenzene is sourced from PubChem (CID 12462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).