C22H25NO2 — CID 124620194
(2S)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-2-phenylpent-4-en-1-one (PubChem CID 124620194) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (2S)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-2-phenylpent-4-en-1-one.
| Compound Name | (2S)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-2-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 124620194 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (2S)-1-(4-hydroxy-4-phenylpiperidin-1-yl)-2-phenylpent-4-en-1-one |
| SMILES | C=CC[C@H](C(=O)N1CCC(O)(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-2-9-20(18-10-5-3-6-11-18)21(24)23-16-14-22(25,15-17-23)19-12-7-4-8-13-19/h2-8,10-13,20,25H,1,9,14-17H2/t20-/m0/s1 |
| InChIKey | BEAAWGPEEHMTKP-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|