About N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide
N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide (PubChem CID 124620815) has the molecular formula C16H28N2O3S
and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide.
Molecular Properties
| Compound Name | N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
| PubChem CID | 124620815 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
| SMILES | CC1(C)CC[C@@H](CNC(=O)N2CCSC3(CCOCC3)C2)O1 |
| InChI | InChI=1S/C16H28N2O3S/c1-15(2)4-3-13(21-15)11-17-14(19)18-7-10-22-16(12-18)5-8-20-9-6-16/h13H,3-12H2,1-2H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | BZEAZPBJXCYNJW-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The IUPAC name of N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide (CID 124620815) is N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide.
What is the SMILES notation for N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The canonical SMILES for N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide is CC1(C)CC[C@@H](CNC(=O)N2CCSC3(CCOCC3)C2)O1.
What is the InChIKey of N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
The InChIKey is BZEAZPBJXCYNJW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H28N2O3S/c1-15(2)4-3-13(21-15)11-17-14(19)18-7-10-22-16(12-18)5-8-20-9-6-16/h13H,3-12H2,1-2H3,(H,17,19)/t13-/m0/s1.
What are the key properties of N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide?
N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide has a molecular weight of 328.48 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]-9-oxa-1-thia-4-azaspiro[5.5]undecane-4-carboxamide is sourced from PubChem (CID 124620815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).