C17H32N2O — CID 124620888
1-cyclohexyl-N-[(1S,3S)-3-methoxycyclopentyl]piperidin-4-amine (PubChem CID 124620888) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(1S,3S)-3-methoxycyclopentyl]piperidin-4-amine.
| Compound Name | 1-cyclohexyl-N-[(1S,3S)-3-methoxycyclopentyl]piperidin-4-amine |
|---|---|
| PubChem CID | 124620888 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 1-cyclohexyl-N-[(1S,3S)-3-methoxycyclopentyl]piperidin-4-amine |
| SMILES | CO[C@H]1CC[C@H](NC2CCN(C3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C17H32N2O/c1-20-17-8-7-15(13-17)18-14-9-11-19(12-10-14)16-5-3-2-4-6-16/h14-18H,2-13H2,1H3/t15-,17-/m0/s1 |
| InChIKey | WVLNUFGPFOQVIA-RDJZCZTQSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |