About 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide
4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide (PubChem CID 124621488) has the molecular formula C15H21ClN2O2
and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide |
| PubChem CID | 124621488 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NCC[C@H]1CCCO1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-18(2)15(19)13-6-5-11(16)10-14(13)17-8-7-12-4-3-9-20-12/h5-6,10,12,17H,3-4,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | SEFGIYJZMMHYNF-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide?
The IUPAC name of 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide (CID 124621488) is 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide.
What is the SMILES notation for 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide?
The canonical SMILES for 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide is CN(C)C(=O)c1ccc(Cl)cc1NCC[C@H]1CCCO1.
What is the InChIKey of 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide?
The InChIKey is SEFGIYJZMMHYNF-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H21ClN2O2/c1-18(2)15(19)13-6-5-11(16)10-14(13)17-8-7-12-4-3-9-20-12/h5-6,10,12,17H,3-4,7-9H2,1-2H3/t12-/m1/s1.
What are the key properties of 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide?
4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide has a molecular weight of 296.80 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,N-dimethyl-2-[2-[(2R)-oxolan-2-yl]ethylamino]benzamide is sourced from PubChem (CID 124621488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).