C19H25FN4O — CID 124621710
4-[(3R)-1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]morpholine (PubChem CID 124621710) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-[(3R)-1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]morpholine.
| Compound Name | 4-[(3R)-1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 124621710 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-[(3R)-1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]morpholine |
| SMILES | Fc1ccc(Cn2cc(CN3CC[C@@H](N4CCOCC4)C3)cn2)cc1 |
| InChI | InChI=1S/C19H25FN4O/c20-18-3-1-16(2-4-18)13-24-14-17(11-21-24)12-22-6-5-19(15-22)23-7-9-25-10-8-23/h1-4,11,14,19H,5-10,12-13,15H2/t19-/m1/s1 |
| InChIKey | NJFGROJPVWWODW-LJQANCHMSA-N |
| XLogP | 1.98 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |