C17H21N3O2S — CID 124621868
2-(cyanomethylsulfanyl)-N-[(3S)-2-oxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]acetamide (PubChem CID 124621868) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[(3S)-2-oxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[(3S)-2-oxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 124621868 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[(3S)-2-oxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]acetamide |
| SMILES | Cc1cc(C)c(N2CC[C@H](NC(=O)CSCC#N)C2=O)c(C)c1 |
| InChI | InChI=1S/C17H21N3O2S/c1-11-8-12(2)16(13(3)9-11)20-6-4-14(17(20)22)19-15(21)10-23-7-5-18/h8-9,14H,4,6-7,10H2,1-3H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | JQHGHZBGTZJVQV-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|