C16H24N6O2 — CID 124621996
1-(2-methoxyethyl)-N-[(6S)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrazole-3-carboxamide (PubChem CID 124621996) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-[(6S)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-[(6S)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 124621996 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-(2-methoxyethyl)-N-[(6S)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrazole-3-carboxamide |
| SMILES | COCCn1ccc(C(=O)N[C@H]2CCc3nc(C(C)C)nn3C2)n1 |
| InChI | InChI=1S/C16H24N6O2/c1-11(2)15-18-14-5-4-12(10-22(14)20-15)17-16(23)13-6-7-21(19-13)8-9-24-3/h6-7,11-12H,4-5,8-10H2,1-3H3,(H,17,23)/t12-/m0/s1 |
| InChIKey | WKPOBYBCUURTEN-LBPRGKRZSA-N |
| XLogP | 0.99 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |