C19H29N5O — CID 124622673
(3S)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-(3-methoxyphenyl)piperidin-3-amine (PubChem CID 124622673) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is (3S)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-(3-methoxyphenyl)piperidin-3-amine.
| Compound Name | (3S)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-(3-methoxyphenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 124622673 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | (3S)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-(3-methoxyphenyl)piperidin-3-amine |
| SMILES | COc1cccc(N2CCC[C@H](NCc3cn(C(C)(C)C)nn3)C2)c1 |
| InChI | InChI=1S/C19H29N5O/c1-19(2,3)24-14-16(21-22-24)12-20-15-7-6-10-23(13-15)17-8-5-9-18(11-17)25-4/h5,8-9,11,14-15,20H,6-7,10,12-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | BBKNHKFTWQAZNH-HNNXBMFYSA-N |
| XLogP | 2.80 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |