C16H27NO3 — CID 124623493
2-[(1S)-cyclopent-2-en-1-yl]-N-[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]acetamide (PubChem CID 124623493) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]acetamide |
|---|---|
| PubChem CID | 124623493 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]acetamide |
| SMILES | CCO[C@@H]1C[C@](O)(CNC(=O)C[C@H]2C=CCC2)C1(C)C |
| InChI | InChI=1S/C16H27NO3/c1-4-20-13-10-16(19,15(13,2)3)11-17-14(18)9-12-7-5-6-8-12/h5,7,12-13,19H,4,6,8-11H2,1-3H3,(H,17,18)/t12-,13+,16-/m0/s1 |
| InChIKey | PLNUCLFVALFYLS-ZENOOKHLSA-N |
| XLogP | 2.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|