C14H21NOS — CID 124624144
[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(5R)-5-methyl-1,4-thiazepan-4-yl]methanone (PubChem CID 124624144) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(5R)-5-methyl-1,4-thiazepan-4-yl]methanone.
| Compound Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(5R)-5-methyl-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 124624144 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(5R)-5-methyl-1,4-thiazepan-4-yl]methanone |
| SMILES | C[C@@H]1CCSCCN1C(=O)[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H21NOS/c1-10-4-6-17-7-5-15(10)14(16)13-9-11-2-3-12(13)8-11/h2-3,10-13H,4-9H2,1H3/t10-,11+,12+,13+/m1/s1 |
| InChIKey | SRCFDMOLGYUWJD-VOAKCMCISA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|