C13H13N3O3S — CID 124624392
N-[(1R)-1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]ethyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 124624392) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[(1R)-1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]ethyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[(1R)-1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]ethyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124624392 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[(1R)-1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]ethyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | C[C@@H](Nc1ncc([N+](=O)[O-])s1)[C@@H]1COc2ccccc21 |
| InChI | InChI=1S/C13H13N3O3S/c1-8(15-13-14-6-12(20-13)16(17)18)10-7-19-11-5-3-2-4-9(10)11/h2-6,8,10H,7H2,1H3,(H,14,15)/t8-,10+/m1/s1 |
| InChIKey | FIVMJVMRTJETKU-SCZZXKLOSA-N |
| XLogP | 3.03 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|