C17H24N4O — CID 124625019
N,N-dimethyl-5-[[[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]methyl]-1,2,4-oxadiazol-3-amine (PubChem CID 124625019) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N,N-dimethyl-5-[[[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]methyl]-1,2,4-oxadiazol-3-amine.
| Compound Name | N,N-dimethyl-5-[[[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]methyl]-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 124625019 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N,N-dimethyl-5-[[[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]methyl]-1,2,4-oxadiazol-3-amine |
| SMILES | C[C@@H](NCc1nc(N(C)C)no1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H24N4O/c1-12(18-11-16-19-17(20-22-16)21(2)3)14-9-8-13-6-4-5-7-15(13)10-14/h8-10,12,18H,4-7,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | SKLGJXRGPISLJN-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |