About 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline
6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 124625585) has the molecular formula C13H17F2NO3S
and a molecular weight of 305.35 g/mol. Its IUPAC name is 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 124625585 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CO[C@H](C)CS(=O)(=O)N1CCCc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C13H17F2NO3S/c1-9(19-2)8-20(17,18)16-5-3-4-10-6-11(14)7-12(15)13(10)16/h6-7,9H,3-5,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | HYXFWXBJBMRUSU-SECBINFHSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline (CID 124625585) is 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline is CO[C@H](C)CS(=O)(=O)N1CCCc2cc(F)cc(F)c21.
What is the InChIKey of 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline?
The InChIKey is HYXFWXBJBMRUSU-SECBINFHSA-N. The full InChI is InChI=1S/C13H17F2NO3S/c1-9(19-2)8-20(17,18)16-5-3-4-10-6-11(14)7-12(15)13(10)16/h6-7,9H,3-5,8H2,1-2H3/t9-/m1/s1.
What are the key properties of 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline?
6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline has a molecular weight of 305.35 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-difluoro-1-[(2R)-2-methoxypropyl]sulfonyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 124625585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).