C20H23N5O — CID 124625838
(5S)-N-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine (PubChem CID 124625838) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is (5S)-N-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine.
| Compound Name | (5S)-N-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 124625838 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (5S)-N-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]methyl]-2,3,4,5-tetrahydro-1H-1-benzazepin-5-amine |
| SMILES | c1ccc(OCc2nc(CN[C@H]3CCCNc4ccccc43)n[nH]2)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-2-7-15(8-3-1)26-14-20-23-19(24-25-20)13-22-18-11-6-12-21-17-10-5-4-9-16(17)18/h1-5,7-10,18,21-22H,6,11-14H2,(H,23,24,25)/t18-/m0/s1 |
| InChIKey | KHZWYAJKEDITMP-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |