About 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone
1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone (PubChem CID 124626452) has the molecular formula C23H27NO2
and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone |
| PubChem CID | 124626452 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone |
| SMILES | O=C(C[C@H]1CCCOC1)N1CCc2ccccc2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c25-23(16-19-9-6-14-26-17-19)24-13-12-20-10-4-5-11-21(20)22(24)15-18-7-2-1-3-8-18/h1-5,7-8,10-11,19,22H,6,9,12-17H2/t19-,22-/m1/s1 |
| InChIKey | JAJHHBWXKPDSJD-DENIHFKCSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone?
The IUPAC name of 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone (CID 124626452) is 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone.
What is the SMILES notation for 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone?
The canonical SMILES for 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone is O=C(C[C@H]1CCCOC1)N1CCc2ccccc2[C@H]1Cc1ccccc1.
What is the InChIKey of 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone?
The InChIKey is JAJHHBWXKPDSJD-DENIHFKCSA-N. The full InChI is InChI=1S/C23H27NO2/c25-23(16-19-9-6-14-26-17-19)24-13-12-20-10-4-5-11-21(20)22(24)15-18-7-2-1-3-8-18/h1-5,7-8,10-11,19,22H,6,9,12-17H2/t19-,22-/m1/s1.
What are the key properties of 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone?
1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone has a molecular weight of 349.47 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-[(3R)-oxan-3-yl]ethanone is sourced from PubChem (CID 124626452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).