C18H23N3O2 — CID 124627250
1-[(1S,2R)-2-(2-hydroxyethyl)cyclopentyl]-3-(quinolin-6-ylmethyl)urea (PubChem CID 124627250) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(2-hydroxyethyl)cyclopentyl]-3-(quinolin-6-ylmethyl)urea.
| Compound Name | 1-[(1S,2R)-2-(2-hydroxyethyl)cyclopentyl]-3-(quinolin-6-ylmethyl)urea |
|---|---|
| PubChem CID | 124627250 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(1S,2R)-2-(2-hydroxyethyl)cyclopentyl]-3-(quinolin-6-ylmethyl)urea |
| SMILES | O=C(NCc1ccc2ncccc2c1)N[C@H]1CCC[C@@H]1CCO |
| InChI | InChI=1S/C18H23N3O2/c22-10-8-14-3-1-5-17(14)21-18(23)20-12-13-6-7-16-15(11-13)4-2-9-19-16/h2,4,6-7,9,11,14,17,22H,1,3,5,8,10,12H2,(H2,20,21,23)/t14-,17+/m1/s1 |
| InChIKey | HLDQOKWHDNMAET-PBHICJAKSA-N |
| XLogP | 2.59 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |