About (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide
(2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide (PubChem CID 124627342) has the molecular formula C15H21NO4S
and a molecular weight of 311.40 g/mol. Its IUPAC name is (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide.
Molecular Properties
| Compound Name | (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide |
| PubChem CID | 124627342 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide |
| SMILES | CCO[C@@H](C(=O)NC1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-20-14(12-6-4-3-5-7-12)15(17)16-13-8-10-21(18,19)11-9-13/h3-7,13-14H,2,8-11H2,1H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | ANFSAKRQYNEHSN-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide?
The IUPAC name of (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide (CID 124627342) is (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide.
What is the SMILES notation for (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide?
The canonical SMILES for (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide is CCO[C@@H](C(=O)NC1CCS(=O)(=O)CC1)c1ccccc1.
What is the InChIKey of (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide?
The InChIKey is ANFSAKRQYNEHSN-CQSZACIVSA-N. The full InChI is InChI=1S/C15H21NO4S/c1-2-20-14(12-6-4-3-5-7-12)15(17)16-13-8-10-21(18,19)11-9-13/h3-7,13-14H,2,8-11H2,1H3,(H,16,17)/t14-/m1/s1.
What are the key properties of (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide?
(2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide has a molecular weight of 311.40 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(1,1-dioxothian-4-yl)-2-ethoxy-2-phenylacetamide is sourced from PubChem (CID 124627342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).