About (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide
(6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide (PubChem CID 124627758) has the molecular formula C18H24N2O3S
and a molecular weight of 348.47 g/mol. Its IUPAC name is (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide.
Molecular Properties
| Compound Name | (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide |
| PubChem CID | 124627758 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide |
| SMILES | CCCOc1cccc2c(N3CCS(=O)(=O)C[C@H](C)C3)ccnc12 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-10-23-17-6-4-5-15-16(7-8-19-18(15)17)20-9-11-24(21,22)13-14(2)12-20/h4-8,14H,3,9-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | GPIIFHFJMDXGIF-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide?
The IUPAC name of (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide (CID 124627758) is (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide.
What is the SMILES notation for (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide?
The canonical SMILES for (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide is CCCOc1cccc2c(N3CCS(=O)(=O)C[C@H](C)C3)ccnc12.
What is the InChIKey of (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide?
The InChIKey is GPIIFHFJMDXGIF-CQSZACIVSA-N. The full InChI is InChI=1S/C18H24N2O3S/c1-3-10-23-17-6-4-5-15-16(7-8-19-18(15)17)20-9-11-24(21,22)13-14(2)12-20/h4-8,14H,3,9-13H2,1-2H3/t14-/m1/s1.
What are the key properties of (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide?
(6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide has a molecular weight of 348.47 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-4-(8-propoxyquinolin-4-yl)-1,4-thiazepane 1,1-dioxide is sourced from PubChem (CID 124627758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).