C18H21N5S — CID 124628135
N-[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-5-piperidin-1-ylpyridin-2-amine (PubChem CID 124628135) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is N-[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-5-piperidin-1-ylpyridin-2-amine.
| Compound Name | N-[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-5-piperidin-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 124628135 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-5-piperidin-1-ylpyridin-2-amine |
| SMILES | c1csc([C@H](Nc2ccc(N3CCCCC3)cn2)c2ncc[nH]2)c1 |
| InChI | InChI=1S/C18H21N5S/c1-2-10-23(11-3-1)14-6-7-16(21-13-14)22-17(15-5-4-12-24-15)18-19-8-9-20-18/h4-9,12-13,17H,1-3,10-11H2,(H,19,20)(H,21,22)/t17-/m0/s1 |
| InChIKey | QUXZIBAIZJXVQA-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |