C15H24N4 — CID 124628337
1-[[(3S)-1-benzylpyrrolidin-3-yl]methyl]-2,3-dimethylguanidine (PubChem CID 124628337) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[[(3S)-1-benzylpyrrolidin-3-yl]methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[[(3S)-1-benzylpyrrolidin-3-yl]methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 124628337 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-[[(3S)-1-benzylpyrrolidin-3-yl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NC[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H24N4/c1-16-15(17-2)18-10-14-8-9-19(12-14)11-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H2,16,17,18)/t14-/m0/s1 |
| InChIKey | RHTAPFYIMSXFJI-AWEZNQCLSA-N |
| XLogP | 1.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|