C13H15F3N4O2S — CID 124628397
(3S)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione (PubChem CID 124628397) has the molecular formula C13H15F3N4O2S and a molecular weight of 348.35 g/mol. Its IUPAC name is (3S)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 124628397 |
| Molecular Formula | C13H15F3N4O2S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (3S)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(c3nccs3)CC2)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C13H15F3N4O2S/c14-13(15,16)8-20-10(21)7-9(11(20)22)18-2-4-19(5-3-18)12-17-1-6-23-12/h1,6,9H,2-5,7-8H2/t9-/m0/s1 |
| InChIKey | QJVCWXQRTWZMEN-VIFPVBQESA-N |
| XLogP | 0.95 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|