C15H22Cl2N2O4S — CID 124628988
(2S,6S)-N-[3-(2,4-dichlorophenoxy)propyl]-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 124628988) has the molecular formula C15H22Cl2N2O4S and a molecular weight of 397.32 g/mol. Its IUPAC name is (2S,6S)-N-[3-(2,4-dichlorophenoxy)propyl]-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | (2S,6S)-N-[3-(2,4-dichlorophenoxy)propyl]-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 124628988 |
| Molecular Formula | C15H22Cl2N2O4S |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (2S,6S)-N-[3-(2,4-dichlorophenoxy)propyl]-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | C[C@H]1CN(S(=O)(=O)NCCCOc2ccc(Cl)cc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C15H22Cl2N2O4S/c1-11-9-19(10-12(2)23-11)24(20,21)18-6-3-7-22-15-5-4-13(16)8-14(15)17/h4-5,8,11-12,18H,3,6-7,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | VSRQTQASZMJZBW-RYUDHWBXSA-N |
| XLogP | 2.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|