About fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane
fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane (PubChem CID 124629075) has the molecular formula C27H57FSi
and a molecular weight of 428.84 g/mol. Its IUPAC name is fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane.
Molecular Properties
| Compound Name | fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane |
| PubChem CID | 124629075 |
| Molecular Formula | C27H57FSi |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.42 |
| IUPAC Name | fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane |
| SMILES | C[C@H](CC[Si](F)(CC[C@@H](C)CC(C)(C)C)CC[C@@H](C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C27H57FSi/c1-22(19-25(4,5)6)13-16-29(28,17-14-23(2)20-26(7,8)9)18-15-24(3)21-27(10,11)12/h22-24H,13-21H2,1-12H3/t22-,23-,24-/m1/s1 |
| InChIKey | DOVZSAPEEYIGFE-WXFUMESZSA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane?
The IUPAC name of fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane (CID 124629075) is fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane.
What is the SMILES notation for fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane?
The canonical SMILES for fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane is C[C@H](CC[Si](F)(CC[C@@H](C)CC(C)(C)C)CC[C@@H](C)CC(C)(C)C)CC(C)(C)C.
What is the InChIKey of fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane?
The InChIKey is DOVZSAPEEYIGFE-WXFUMESZSA-N. The full InChI is InChI=1S/C27H57FSi/c1-22(19-25(4,5)6)13-16-29(28,17-14-23(2)20-26(7,8)9)18-15-24(3)21-27(10,11)12/h22-24H,13-21H2,1-12H3/t22-,23-,24-/m1/s1.
What are the key properties of fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane?
fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane has a molecular weight of 428.84 g/mol, XLogP of 10.29, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-tris[(3S)-3,5,5-trimethylhexyl]silane is sourced from PubChem (CID 124629075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).