C27H57FSi — CID 124629076
fluoro-[(3S)-3,5,5-trimethylhexyl]-bis[(3R)-3,5,5-trimethylhexyl]silane (PubChem CID 124629076) has the molecular formula C27H57FSi and a molecular weight of 428.84 g/mol. Its IUPAC name is fluoro-[(3S)-3,5,5-trimethylhexyl]-bis[(3R)-3,5,5-trimethylhexyl]silane.
| Compound Name | fluoro-[(3S)-3,5,5-trimethylhexyl]-bis[(3R)-3,5,5-trimethylhexyl]silane |
|---|---|
| PubChem CID | 124629076 |
| Molecular Formula | C27H57FSi |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.42 |
| IUPAC Name | fluoro-[(3S)-3,5,5-trimethylhexyl]-bis[(3R)-3,5,5-trimethylhexyl]silane |
| SMILES | C[C@H](CC[Si](F)(CC[C@H](C)CC(C)(C)C)CC[C@H](C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C27H57FSi/c1-22(19-25(4,5)6)13-16-29(28,17-14-23(2)20-26(7,8)9)18-15-24(3)21-27(10,11)12/h22-24H,13-21H2,1-12H3/t22-,23-,24+/m0/s1 |
| InChIKey | DOVZSAPEEYIGFE-KMDXXIMOSA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|