C20H26N2O4Sn — CID 124629701
[[(2S)-2-amino-3-phenylpropanoyl]oxy-dimethylstannyl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 124629701) has the molecular formula C20H26N2O4Sn and a molecular weight of 477.15 g/mol. Its IUPAC name is [[(2S)-2-amino-3-phenylpropanoyl]oxy-dimethylstannyl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [[(2S)-2-amino-3-phenylpropanoyl]oxy-dimethylstannyl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 124629701 |
| Molecular Formula | C20H26N2O4Sn |
| Molecular Weight | 477.15 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | [[(2S)-2-amino-3-phenylpropanoyl]oxy-dimethylstannyl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | C[Sn](C)(OC(=O)[C@@H](N)Cc1ccccc1)OC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/2C9H11NO2.2CH3.Sn/c2*10-8(9(11)12)6-7-4-2-1-3-5-7;;;/h2*1-5,8H,6,10H2,(H,11,12);2*1H3;/q;;;;+2/p-2/t2*8-;;;/m00.../s1 |
| InChIKey | UIWNEUPWWZZJML-VSODYHHCSA-L |
| XLogP | 1.91 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |