About [(1S,2S)-2-bromocyclopropyl]methanol
[(1S,2S)-2-bromocyclopropyl]methanol (PubChem CID 124629911) has the molecular formula C4H7BrO
and a molecular weight of 151.00 g/mol. Its IUPAC name is [(1S,2S)-2-bromocyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2S)-2-bromocyclopropyl]methanol |
| PubChem CID | 124629911 |
| Molecular Formula | C4H7BrO |
| Molecular Weight | 151.00 g/mol |
| Exact Mass | 149.97 |
| IUPAC Name | [(1S,2S)-2-bromocyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@@H]1Br |
| InChI | InChI=1S/C4H7BrO/c5-4-1-3(4)2-6/h3-4,6H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | SOUNJUAOSVUXMT-IMJSIDKUSA-N |
| XLogP | 0.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.00 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-bromocyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-bromocyclopropyl]methanol?
The IUPAC name of [(1S,2S)-2-bromocyclopropyl]methanol (CID 124629911) is [(1S,2S)-2-bromocyclopropyl]methanol.
What is the SMILES notation for [(1S,2S)-2-bromocyclopropyl]methanol?
The canonical SMILES for [(1S,2S)-2-bromocyclopropyl]methanol is OC[C@@H]1C[C@@H]1Br.
What is the InChIKey of [(1S,2S)-2-bromocyclopropyl]methanol?
The InChIKey is SOUNJUAOSVUXMT-IMJSIDKUSA-N. The full InChI is InChI=1S/C4H7BrO/c5-4-1-3(4)2-6/h3-4,6H,1-2H2/t3-,4-/m0/s1.
What are the key properties of [(1S,2S)-2-bromocyclopropyl]methanol?
[(1S,2S)-2-bromocyclopropyl]methanol has a molecular weight of 151.00 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-bromocyclopropyl]methanol is sourced from PubChem (CID 124629911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).