C11H21NO3 — CID 124630009
prop-2-enyl (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate (PubChem CID 124630009) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is prop-2-enyl (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate.
| Compound Name | prop-2-enyl (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate |
|---|---|
| PubChem CID | 124630009 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | prop-2-enyl (2S,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate |
| SMILES | C=CCOC(=O)[C@@H](N)[C@H](C)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-6-7-14-10(13)9(12)8(2)15-11(3,4)5/h6,8-9H,1,7,12H2,2-5H3/t8-,9-/m0/s1 |
| InChIKey | SDTMVIKHZLMJBS-IUCAKERBSA-N |
| XLogP | 1.25 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|