C19H13N5O5S — CID 124632125
(3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-yl-N-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)butanamide (PubChem CID 124632125) has the molecular formula C19H13N5O5S and a molecular weight of 423.41 g/mol. Its IUPAC name is (3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-yl-N-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)butanamide.
| Compound Name | (3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-yl-N-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)butanamide |
|---|---|
| PubChem CID | 124632125 |
| Molecular Formula | C19H13N5O5S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-yl-N-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)butanamide |
| SMILES | O=C(Nc1nc(=S)[nH][nH]1)C(=O)[C@H](C(=O)c1ccncc1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C19H13N5O5S/c25-13(9-5-7-20-8-6-9)12(14(26)16(27)21-18-22-19(30)24-23-18)15-10-3-1-2-4-11(10)17(28)29-15/h1-8,12,15H,(H3,21,22,23,24,27,30)/t12-,15-/m0/s1 |
| InChIKey | CLRAYLKWXAPCGD-WFASDCNBSA-N |
| XLogP | 1.78 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|