About 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol
2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol (PubChem CID 124634014) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol.
Molecular Properties
| Compound Name | 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol |
| PubChem CID | 124634014 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)S)[C@H](NN)C1 |
| InChI | InChI=1S/C10H22N2S/c1-7-4-5-8(10(2,3)13)9(6-7)12-11/h7-9,12-13H,4-6,11H2,1-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | NDWXVBXUQDEDLN-IWSPIJDZSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol?
The IUPAC name of 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol (CID 124634014) is 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol.
What is the SMILES notation for 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol?
The canonical SMILES for 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol is C[C@@H]1CC[C@@H](C(C)(C)S)[C@H](NN)C1.
What is the InChIKey of 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol?
The InChIKey is NDWXVBXUQDEDLN-IWSPIJDZSA-N. The full InChI is InChI=1S/C10H22N2S/c1-7-4-5-8(10(2,3)13)9(6-7)12-11/h7-9,12-13H,4-6,11H2,1-3H3/t7-,8-,9-/m1/s1.
What are the key properties of 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol?
2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol has a molecular weight of 202.37 g/mol, XLogP of 1.96, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R,4R)-2-hydrazinyl-4-methylcyclohexyl]propane-2-thiol is sourced from PubChem (CID 124634014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).