About tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate
tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate (PubChem CID 124636263) has the molecular formula C14H22FNO4
and a molecular weight of 287.33 g/mol. Its IUPAC name is tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate |
| PubChem CID | 124636263 |
| Molecular Formula | C14H22FNO4 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C1\CCN(C(=O)OC(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C14H22FNO4/c1-5-19-12(17)8-10-6-7-16(9-11(10)15)13(18)20-14(2,3)4/h8,11H,5-7,9H2,1-4H3/b10-8+/t11-/m1/s1 |
| InChIKey | OJLWXVWHUZEEPZ-RJCSOLBVSA-N |
| XLogP | 2.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate (CID 124636263) is tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate is CCOC(=O)/C=C1\CCN(C(=O)OC(C)(C)C)C[C@H]1F.
What is the InChIKey of tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate?
The InChIKey is OJLWXVWHUZEEPZ-RJCSOLBVSA-N. The full InChI is InChI=1S/C14H22FNO4/c1-5-19-12(17)8-10-6-7-16(9-11(10)15)13(18)20-14(2,3)4/h8,11H,5-7,9H2,1-4H3/b10-8+/t11-/m1/s1.
What are the key properties of tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate?
tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate has a molecular weight of 287.33 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4E)-4-(2-ethoxy-2-oxoethylidene)-3-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 124636263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).