C13H18O6S2 — CID 124636781
[(2S)-6-methylsulfonyloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methyl methanesulfonate (PubChem CID 124636781) has the molecular formula C13H18O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [(2S)-6-methylsulfonyloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methyl methanesulfonate.
| Compound Name | [(2S)-6-methylsulfonyloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 124636781 |
| Molecular Formula | C13H18O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [(2S)-6-methylsulfonyloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CCc2cc(OS(C)(=O)=O)ccc2C1 |
| InChI | InChI=1S/C13H18O6S2/c1-20(14,15)18-9-10-3-4-12-8-13(19-21(2,16)17)6-5-11(12)7-10/h5-6,8,10H,3-4,7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | DXQQUOXEFJFECU-JTQLQIEISA-N |
| XLogP | 1.11 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|