C18H17ClO3 — CID 124637359
methyl 4-[(1R,2R)-2-(2-chloro-4-methoxyphenyl)cyclopropyl]benzoate (PubChem CID 124637359) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is methyl 4-[(1R,2R)-2-(2-chloro-4-methoxyphenyl)cyclopropyl]benzoate.
| Compound Name | methyl 4-[(1R,2R)-2-(2-chloro-4-methoxyphenyl)cyclopropyl]benzoate |
|---|---|
| PubChem CID | 124637359 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 4-[(1R,2R)-2-(2-chloro-4-methoxyphenyl)cyclopropyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C[C@H]2c2ccc(OC)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17ClO3/c1-21-13-7-8-14(17(19)9-13)16-10-15(16)11-3-5-12(6-4-11)18(20)22-2/h3-9,15-16H,10H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | VIVGSRDJJBDFHB-HOTGVXAUSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |