About ethyl (3R)-3-amino-5,5-diethoxypentanoate
ethyl (3R)-3-amino-5,5-diethoxypentanoate (PubChem CID 124638352) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is ethyl (3R)-3-amino-5,5-diethoxypentanoate.
Molecular Properties
| Compound Name | ethyl (3R)-3-amino-5,5-diethoxypentanoate |
| PubChem CID | 124638352 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | ethyl (3R)-3-amino-5,5-diethoxypentanoate |
| SMILES | CCOC(=O)C[C@H](N)CC(OCC)OCC |
| InChI | InChI=1S/C11H23NO4/c1-4-14-10(13)7-9(12)8-11(15-5-2)16-6-3/h9,11H,4-8,12H2,1-3H3/t9-/m0/s1 |
| InChIKey | ZEEYYJCUOPRZKN-VIFPVBQESA-N |
| XLogP | 1.06 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R)-3-amino-5,5-diethoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-amino-5,5-diethoxypentanoate?
The IUPAC name of ethyl (3R)-3-amino-5,5-diethoxypentanoate (CID 124638352) is ethyl (3R)-3-amino-5,5-diethoxypentanoate.
What is the SMILES notation for ethyl (3R)-3-amino-5,5-diethoxypentanoate?
The canonical SMILES for ethyl (3R)-3-amino-5,5-diethoxypentanoate is CCOC(=O)C[C@H](N)CC(OCC)OCC.
What is the InChIKey of ethyl (3R)-3-amino-5,5-diethoxypentanoate?
The InChIKey is ZEEYYJCUOPRZKN-VIFPVBQESA-N. The full InChI is InChI=1S/C11H23NO4/c1-4-14-10(13)7-9(12)8-11(15-5-2)16-6-3/h9,11H,4-8,12H2,1-3H3/t9-/m0/s1.
What are the key properties of ethyl (3R)-3-amino-5,5-diethoxypentanoate?
ethyl (3R)-3-amino-5,5-diethoxypentanoate has a molecular weight of 233.31 g/mol, XLogP of 1.06, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-amino-5,5-diethoxypentanoate is sourced from PubChem (CID 124638352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).