C7H11NO5S — CID 124638493
[(1S,6R)-3-amino-1-hydroxy-6-methylcyclohexa-2,4-dien-1-yl] hydrogen sulfate (PubChem CID 124638493) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is [(1S,6R)-3-amino-1-hydroxy-6-methylcyclohexa-2,4-dien-1-yl] hydrogen sulfate.
| Compound Name | [(1S,6R)-3-amino-1-hydroxy-6-methylcyclohexa-2,4-dien-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 124638493 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | [(1S,6R)-3-amino-1-hydroxy-6-methylcyclohexa-2,4-dien-1-yl] hydrogen sulfate |
| SMILES | C[C@@H]1C=CC(N)=C[C@@]1(O)OS(=O)(=O)O |
| InChI | InChI=1S/C7H11NO5S/c1-5-2-3-6(8)4-7(5,9)13-14(10,11)12/h2-5,9H,8H2,1H3,(H,10,11,12)/t5-,7-/m1/s1 |
| InChIKey | OAIITIMQIDEARW-IYSWYEEDSA-N |
| XLogP | -0.46 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|