C10H8F3NO2S — CID 124638608
(3S)-3-hydroxy-6-methylsulfanyl-3-(trifluoromethyl)-1H-indol-2-one (PubChem CID 124638608) has the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. Its IUPAC name is (3S)-3-hydroxy-6-methylsulfanyl-3-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3S)-3-hydroxy-6-methylsulfanyl-3-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 124638608 |
| Molecular Formula | C10H8F3NO2S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (3S)-3-hydroxy-6-methylsulfanyl-3-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CSc1ccc2c(c1)NC(=O)[C@]2(O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2S/c1-17-5-2-3-6-7(4-5)14-8(15)9(6,16)10(11,12)13/h2-4,16H,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | XSSTWAIOCDYENT-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |